C20H24ClN5O2 — CID 53046358
N-butyl-3-[2-(4-chlorophenyl)-4,5-dimethyl-7-oxo-[1,2,4]triazolo[1,5-a]pyrimidin-6-yl]propanamide (PubChem CID 53046358) has the molecular formula C20H24ClN5O2 and a molecular weight of 401.90 g/mol. Its IUPAC name is N-butyl-3-[2-(4-chlorophenyl)-4,5-dimethyl-7-oxo-[1,2,4]triazolo[1,5-a]pyrimidin-6-yl]propanamide.
| Compound Name | N-butyl-3-[2-(4-chlorophenyl)-4,5-dimethyl-7-oxo-[1,2,4]triazolo[1,5-a]pyrimidin-6-yl]propanamide |
|---|---|
| PubChem CID | 53046358 |
| Molecular Formula | C20H24ClN5O2 |
| Molecular Weight | 401.90 g/mol |
| Exact Mass | 401.16 |
| IUPAC Name | N-butyl-3-[2-(4-chlorophenyl)-4,5-dimethyl-7-oxo-[1,2,4]triazolo[1,5-a]pyrimidin-6-yl]propanamide |
| SMILES | CCCCNC(=O)CCc1c(C)n(C)c2nc(-c3ccc(Cl)cc3)nn2c1=O |
| InChI | InChI=1S/C20H24ClN5O2/c1-4-5-12-22-17(27)11-10-16-13(2)25(3)20-23-18(24-26(20)19(16)28)14-6-8-15(21)9-7-14/h6-9H,4-5,10-12H2,1-3H3,(H,22,27) |
| InChIKey | IZCBEOYNRMYXKA-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 81.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.90 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|