C16H24N4O — CID 34231119
N-butyl-3-(2,5,7-trimethylpyrazolo[1,5-a]pyrimidin-6-yl)propanamide (PubChem CID 34231119) has the molecular formula C16H24N4O and a molecular weight of 288.40 g/mol. Its IUPAC name is N-butyl-3-(2,5,7-trimethylpyrazolo[1,5-a]pyrimidin-6-yl)propanamide.
| Compound Name | N-butyl-3-(2,5,7-trimethylpyrazolo[1,5-a]pyrimidin-6-yl)propanamide |
|---|---|
| PubChem CID | 34231119 |
| Molecular Formula | C16H24N4O |
| Molecular Weight | 288.40 g/mol |
| Exact Mass | 288.20 |
| IUPAC Name | N-butyl-3-(2,5,7-trimethylpyrazolo[1,5-a]pyrimidin-6-yl)propanamide |
| SMILES | CCCCNC(=O)CCc1c(C)nc2cc(C)nn2c1C |
| InChI | InChI=1S/C16H24N4O/c1-5-6-9-17-16(21)8-7-14-12(3)18-15-10-11(2)19-20(15)13(14)4/h10H,5-9H2,1-4H3,(H,17,21) |
| InChIKey | MGHBHTQLWFFKLE-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 59.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.40 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|