C24H32N4O2 — CID 20863291
N-hexyl-3-[2-(2-methoxyphenyl)-5,7-dimethylpyrazolo[1,5-a]pyrimidin-6-yl]propanamide (PubChem CID 20863291) has the molecular formula C24H32N4O2 and a molecular weight of 408.55 g/mol. Its IUPAC name is N-hexyl-3-[2-(2-methoxyphenyl)-5,7-dimethylpyrazolo[1,5-a]pyrimidin-6-yl]propanamide.
| Compound Name | N-hexyl-3-[2-(2-methoxyphenyl)-5,7-dimethylpyrazolo[1,5-a]pyrimidin-6-yl]propanamide |
|---|---|
| PubChem CID | 20863291 |
| Molecular Formula | C24H32N4O2 |
| Molecular Weight | 408.55 g/mol |
| Exact Mass | 408.25 |
| IUPAC Name | N-hexyl-3-[2-(2-methoxyphenyl)-5,7-dimethylpyrazolo[1,5-a]pyrimidin-6-yl]propanamide |
| SMILES | CCCCCCNC(=O)CCc1c(C)nc2cc(-c3ccccc3OC)nn2c1C |
| InChI | InChI=1S/C24H32N4O2/c1-5-6-7-10-15-25-24(29)14-13-19-17(2)26-23-16-21(27-28(23)18(19)3)20-11-8-9-12-22(20)30-4/h8-9,11-12,16H,5-7,10,13-15H2,1-4H3,(H,25,29) |
| InChIKey | SNCCAXWRZSIQRY-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 68.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.55 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|