C18H28N4O — CID 32646392
N-hexyl-3-(2,5,7-trimethylpyrazolo[1,5-a]pyrimidin-6-yl)propanamide (PubChem CID 32646392) has the molecular formula C18H28N4O and a molecular weight of 316.45 g/mol. Its IUPAC name is N-hexyl-3-(2,5,7-trimethylpyrazolo[1,5-a]pyrimidin-6-yl)propanamide.
| Compound Name | N-hexyl-3-(2,5,7-trimethylpyrazolo[1,5-a]pyrimidin-6-yl)propanamide |
|---|---|
| PubChem CID | 32646392 |
| Molecular Formula | C18H28N4O |
| Molecular Weight | 316.45 g/mol |
| Exact Mass | 316.23 |
| IUPAC Name | N-hexyl-3-(2,5,7-trimethylpyrazolo[1,5-a]pyrimidin-6-yl)propanamide |
| SMILES | CCCCCCNC(=O)CCc1c(C)nc2cc(C)nn2c1C |
| InChI | InChI=1S/C18H28N4O/c1-5-6-7-8-11-19-18(23)10-9-16-14(3)20-17-12-13(2)21-22(17)15(16)4/h12H,5-11H2,1-4H3,(H,19,23) |
| InChIKey | QKIAGTXHGBKWOA-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 59.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.45 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|