C25H26N4O2S — CID 53050080
N-[3-[(3,4-dimethylphenyl)carbamoyl]phenyl]-6,8-dimethyl-2,3-dihydropyrido[2,3-b][1,4]thiazine-1-carboxamide (PubChem CID 53050080) has the molecular formula C25H26N4O2S and a molecular weight of 446.58 g/mol. Its IUPAC name is N-[3-[(3,4-dimethylphenyl)carbamoyl]phenyl]-6,8-dimethyl-2,3-dihydropyrido[2,3-b][1,4]thiazine-1-carboxamide.
| Compound Name | N-[3-[(3,4-dimethylphenyl)carbamoyl]phenyl]-6,8-dimethyl-2,3-dihydropyrido[2,3-b][1,4]thiazine-1-carboxamide |
|---|---|
| PubChem CID | 53050080 |
| Molecular Formula | C25H26N4O2S |
| Molecular Weight | 446.58 g/mol |
| Exact Mass | 446.18 |
| IUPAC Name | N-[3-[(3,4-dimethylphenyl)carbamoyl]phenyl]-6,8-dimethyl-2,3-dihydropyrido[2,3-b][1,4]thiazine-1-carboxamide |
| SMILES | Cc1cc(C)c2c(n1)SCCN2C(=O)Nc1cccc(C(=O)Nc2ccc(C)c(C)c2)c1 |
| InChI | InChI=1S/C25H26N4O2S/c1-15-8-9-21(13-16(15)2)27-23(30)19-6-5-7-20(14-19)28-25(31)29-10-11-32-24-22(29)17(3)12-18(4)26-24/h5-9,12-14H,10-11H2,1-4H3,(H,27,30)(H,28,31) |
| InChIKey | CSGBBJMTKDFVRQ-UHFFFAOYSA-N |
| XLogP | 5.71 |
| TPSA | 74.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.58 |
| LogP ≤ 5 | 5.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |