C25H26N4O4S — CID 53050060
N-[3-[(3,5-dimethoxyphenyl)carbamoyl]phenyl]-6,8-dimethyl-2,3-dihydropyrido[2,3-b][1,4]thiazine-1-carboxamide (PubChem CID 53050060) has the molecular formula C25H26N4O4S and a molecular weight of 478.57 g/mol. Its IUPAC name is N-[3-[(3,5-dimethoxyphenyl)carbamoyl]phenyl]-6,8-dimethyl-2,3-dihydropyrido[2,3-b][1,4]thiazine-1-carboxamide.
| Compound Name | N-[3-[(3,5-dimethoxyphenyl)carbamoyl]phenyl]-6,8-dimethyl-2,3-dihydropyrido[2,3-b][1,4]thiazine-1-carboxamide |
|---|---|
| PubChem CID | 53050060 |
| Molecular Formula | C25H26N4O4S |
| Molecular Weight | 478.57 g/mol |
| Exact Mass | 478.17 |
| IUPAC Name | N-[3-[(3,5-dimethoxyphenyl)carbamoyl]phenyl]-6,8-dimethyl-2,3-dihydropyrido[2,3-b][1,4]thiazine-1-carboxamide |
| SMILES | COc1cc(NC(=O)c2cccc(NC(=O)N3CCSc4nc(C)cc(C)c43)c2)cc(OC)c1 |
| InChI | InChI=1S/C25H26N4O4S/c1-15-10-16(2)26-24-22(15)29(8-9-34-24)25(31)28-18-7-5-6-17(11-18)23(30)27-19-12-20(32-3)14-21(13-19)33-4/h5-7,10-14H,8-9H2,1-4H3,(H,27,30)(H,28,31) |
| InChIKey | MVXQATFUDIYDMN-UHFFFAOYSA-N |
| XLogP | 5.11 |
| TPSA | 92.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.57 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |