C18H18N4O3 — CID 53051729
N-(1,3-benzodioxol-5-ylmethyl)-1-propylbenzotriazole-5-carboxamide (PubChem CID 53051729) has the molecular formula C18H18N4O3 and a molecular weight of 338.37 g/mol. Its IUPAC name is N-(1,3-benzodioxol-5-ylmethyl)-1-propylbenzotriazole-5-carboxamide.
| Compound Name | N-(1,3-benzodioxol-5-ylmethyl)-1-propylbenzotriazole-5-carboxamide |
|---|---|
| PubChem CID | 53051729 |
| Molecular Formula | C18H18N4O3 |
| Molecular Weight | 338.37 g/mol |
| Exact Mass | 338.14 |
| IUPAC Name | N-(1,3-benzodioxol-5-ylmethyl)-1-propylbenzotriazole-5-carboxamide |
| SMILES | CCCn1nnc2cc(C(=O)NCc3ccc4c(c3)OCO4)ccc21 |
| InChI | InChI=1S/C18H18N4O3/c1-2-7-22-15-5-4-13(9-14(15)20-21-22)18(23)19-10-12-3-6-16-17(8-12)25-11-24-16/h3-6,8-9H,2,7,10-11H2,1H3,(H,19,23) |
| InChIKey | DMVNJVPKQCTKFW-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 78.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.37 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |