C22H20F3N5O3 — CID 53052228
methyl 3-[[4-[3-(trifluoromethyl)quinoxalin-2-yl]piperazine-1-carbonyl]amino]benzoate (PubChem CID 53052228) has the molecular formula C22H20F3N5O3 and a molecular weight of 459.43 g/mol. Its IUPAC name is methyl 3-[[4-[3-(trifluoromethyl)quinoxalin-2-yl]piperazine-1-carbonyl]amino]benzoate.
| Compound Name | methyl 3-[[4-[3-(trifluoromethyl)quinoxalin-2-yl]piperazine-1-carbonyl]amino]benzoate |
|---|---|
| PubChem CID | 53052228 |
| Molecular Formula | C22H20F3N5O3 |
| Molecular Weight | 459.43 g/mol |
| Exact Mass | 459.15 |
| IUPAC Name | methyl 3-[[4-[3-(trifluoromethyl)quinoxalin-2-yl]piperazine-1-carbonyl]amino]benzoate |
| SMILES | COC(=O)c1cccc(NC(=O)N2CCN(c3nc4ccccc4nc3C(F)(F)F)CC2)c1 |
| InChI | InChI=1S/C22H20F3N5O3/c1-33-20(31)14-5-4-6-15(13-14)26-21(32)30-11-9-29(10-12-30)19-18(22(23,24)25)27-16-7-2-3-8-17(16)28-19/h2-8,13H,9-12H2,1H3,(H,26,32) |
| InChIKey | BRBRQXXSNNRIQW-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 87.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.43 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |