C15H9ClF2N2S — CID 5305312
4-[(2-chloro-4,5-difluorophenyl)methylsulfanyl]quinazoline (PubChem CID 5305312) has the molecular formula C15H9ClF2N2S and a molecular weight of 322.77 g/mol. Its IUPAC name is 4-[(2-chloro-4,5-difluorophenyl)methylsulfanyl]quinazoline.
| Compound Name | 4-[(2-chloro-4,5-difluorophenyl)methylsulfanyl]quinazoline |
|---|---|
| PubChem CID | 5305312 |
| Molecular Formula | C15H9ClF2N2S |
| Molecular Weight | 322.77 g/mol |
| Exact Mass | 322.01 |
| IUPAC Name | 4-[(2-chloro-4,5-difluorophenyl)methylsulfanyl]quinazoline |
| SMILES | Fc1cc(Cl)c(CSc2ncnc3ccccc23)cc1F |
| InChI | InChI=1S/C15H9ClF2N2S/c16-11-6-13(18)12(17)5-9(11)7-21-15-10-3-1-2-4-14(10)19-8-20-15/h1-6,8H,7H2 |
| InChIKey | WDHDNXBLEKSVJI-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.77 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|