About 2-[4-(4-methoxyphenyl)-3-methyl-7-oxo-[1,2]oxazolo[3,4-d]pyridazin-6-yl]-N-phenylacetamide
2-[4-(4-methoxyphenyl)-3-methyl-7-oxo-[1,2]oxazolo[3,4-d]pyridazin-6-yl]-N-phenylacetamide (PubChem CID 53056462) has the molecular formula C21H18N4O4
and a molecular weight of 390.40 g/mol. Its IUPAC name is 2-[4-(4-methoxyphenyl)-3-methyl-7-oxo-[1,2]oxazolo[3,4-d]pyridazin-6-yl]-N-phenylacetamide.
Molecular Properties
| Compound Name | 2-[4-(4-methoxyphenyl)-3-methyl-7-oxo-[1,2]oxazolo[3,4-d]pyridazin-6-yl]-N-phenylacetamide |
| PubChem CID | 53056462 |
| Molecular Formula | C21H18N4O4 |
| Molecular Weight | 390.40 g/mol |
| Exact Mass | 390.13 |
| IUPAC Name | 2-[4-(4-methoxyphenyl)-3-methyl-7-oxo-[1,2]oxazolo[3,4-d]pyridazin-6-yl]-N-phenylacetamide |
| SMILES | COc1ccc(-c2nn(CC(=O)Nc3ccccc3)c(=O)c3noc(C)c23)cc1 |
| InChI | InChI=1S/C21H18N4O4/c1-13-18-19(14-8-10-16(28-2)11-9-14)23-25(21(27)20(18)24-29-13)12-17(26)22-15-6-4-3-5-7-15/h3-11H,12H2,1-2H3,(H,22,26) |
| InChIKey | KSYXPCWJNABNNR-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 99.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 390.40 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze 2-[4-(4-methoxyphenyl)-3-methyl-7-oxo-[1,2]oxazolo[3,4-d]pyridazin-6-yl]-N-phenylacetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[4-(4-methoxyphenyl)-3-methyl-7-oxo-[1,2]oxazolo[3,4-d]pyridazin-6-yl]-N-phenylacetamide?
The IUPAC name of 2-[4-(4-methoxyphenyl)-3-methyl-7-oxo-[1,2]oxazolo[3,4-d]pyridazin-6-yl]-N-phenylacetamide (CID 53056462) is 2-[4-(4-methoxyphenyl)-3-methyl-7-oxo-[1,2]oxazolo[3,4-d]pyridazin-6-yl]-N-phenylacetamide.
What is the SMILES notation for 2-[4-(4-methoxyphenyl)-3-methyl-7-oxo-[1,2]oxazolo[3,4-d]pyridazin-6-yl]-N-phenylacetamide?
The canonical SMILES for 2-[4-(4-methoxyphenyl)-3-methyl-7-oxo-[1,2]oxazolo[3,4-d]pyridazin-6-yl]-N-phenylacetamide is COc1ccc(-c2nn(CC(=O)Nc3ccccc3)c(=O)c3noc(C)c23)cc1.
What is the InChIKey of 2-[4-(4-methoxyphenyl)-3-methyl-7-oxo-[1,2]oxazolo[3,4-d]pyridazin-6-yl]-N-phenylacetamide?
The InChIKey is KSYXPCWJNABNNR-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H18N4O4/c1-13-18-19(14-8-10-16(28-2)11-9-14)23-25(21(27)20(18)24-29-13)12-17(26)22-15-6-4-3-5-7-15/h3-11H,12H2,1-2H3,(H,22,26).
What are the key properties of 2-[4-(4-methoxyphenyl)-3-methyl-7-oxo-[1,2]oxazolo[3,4-d]pyridazin-6-yl]-N-phenylacetamide?
2-[4-(4-methoxyphenyl)-3-methyl-7-oxo-[1,2]oxazolo[3,4-d]pyridazin-6-yl]-N-phenylacetamide has a molecular weight of 390.40 g/mol, XLogP of 3.01, 5 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[4-(4-methoxyphenyl)-3-methyl-7-oxo-[1,2]oxazolo[3,4-d]pyridazin-6-yl]-N-phenylacetamide is sourced from PubChem (CID 53056462), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).