C23H18F4N4O4 — CID 53056478
2-[4-(4-methoxyphenyl)-3-methyl-7-oxo-[1,2]oxazolo[3,4-d]pyridazin-6-yl]-N-(2,3,5,6-tetrafluorophenyl)butanamide (PubChem CID 53056478) has the molecular formula C23H18F4N4O4 and a molecular weight of 490.41 g/mol. Its IUPAC name is 2-[4-(4-methoxyphenyl)-3-methyl-7-oxo-[1,2]oxazolo[3,4-d]pyridazin-6-yl]-N-(2,3,5,6-tetrafluorophenyl)butanamide.
| Compound Name | 2-[4-(4-methoxyphenyl)-3-methyl-7-oxo-[1,2]oxazolo[3,4-d]pyridazin-6-yl]-N-(2,3,5,6-tetrafluorophenyl)butanamide |
|---|---|
| PubChem CID | 53056478 |
| Molecular Formula | C23H18F4N4O4 |
| Molecular Weight | 490.41 g/mol |
| Exact Mass | 490.13 |
| IUPAC Name | 2-[4-(4-methoxyphenyl)-3-methyl-7-oxo-[1,2]oxazolo[3,4-d]pyridazin-6-yl]-N-(2,3,5,6-tetrafluorophenyl)butanamide |
| SMILES | CCC(C(=O)Nc1c(F)c(F)cc(F)c1F)n1nc(-c2ccc(OC)cc2)c2c(C)onc2c1=O |
| InChI | InChI=1S/C23H18F4N4O4/c1-4-15(22(32)28-21-17(26)13(24)9-14(25)18(21)27)31-23(33)20-16(10(2)35-30-20)19(29-31)11-5-7-12(34-3)8-6-11/h5-9,15H,4H2,1-3H3,(H,28,32) |
| InChIKey | WMBGYHLQKHGZII-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 99.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.41 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|