C16H17N3O5S — CID 53056717
5-[(4-acetylphenyl)sulfonylamino]-2-(dimethylamino)pyridine-3-carboxylic acid (PubChem CID 53056717) has the molecular formula C16H17N3O5S and a molecular weight of 363.40 g/mol. Its IUPAC name is 5-[(4-acetylphenyl)sulfonylamino]-2-(dimethylamino)pyridine-3-carboxylic acid.
| Compound Name | 5-[(4-acetylphenyl)sulfonylamino]-2-(dimethylamino)pyridine-3-carboxylic acid |
|---|---|
| PubChem CID | 53056717 |
| Molecular Formula | C16H17N3O5S |
| Molecular Weight | 363.40 g/mol |
| Exact Mass | 363.09 |
| IUPAC Name | 5-[(4-acetylphenyl)sulfonylamino]-2-(dimethylamino)pyridine-3-carboxylic acid |
| SMILES | CC(=O)c1ccc(S(=O)(=O)Nc2cnc(N(C)C)c(C(=O)O)c2)cc1 |
| InChI | InChI=1S/C16H17N3O5S/c1-10(20)11-4-6-13(7-5-11)25(23,24)18-12-8-14(16(21)22)15(17-9-12)19(2)3/h4-9,18H,1-3H3,(H,21,22) |
| InChIKey | KNDTYADLHYPDES-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 116.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.40 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |