C20H25N3O4S — CID 53056810
5-[(4-ethylphenyl)sulfonylamino]-6-(3-methylpiperidin-1-yl)pyridine-3-carboxylic acid (PubChem CID 53056810) has the molecular formula C20H25N3O4S and a molecular weight of 403.50 g/mol. Its IUPAC name is 5-[(4-ethylphenyl)sulfonylamino]-6-(3-methylpiperidin-1-yl)pyridine-3-carboxylic acid.
| Compound Name | 5-[(4-ethylphenyl)sulfonylamino]-6-(3-methylpiperidin-1-yl)pyridine-3-carboxylic acid |
|---|---|
| PubChem CID | 53056810 |
| Molecular Formula | C20H25N3O4S |
| Molecular Weight | 403.50 g/mol |
| Exact Mass | 403.16 |
| IUPAC Name | 5-[(4-ethylphenyl)sulfonylamino]-6-(3-methylpiperidin-1-yl)pyridine-3-carboxylic acid |
| SMILES | CCc1ccc(S(=O)(=O)Nc2cc(C(=O)O)cnc2N2CCCC(C)C2)cc1 |
| InChI | InChI=1S/C20H25N3O4S/c1-3-15-6-8-17(9-7-15)28(26,27)22-18-11-16(20(24)25)12-21-19(18)23-10-4-5-14(2)13-23/h6-9,11-12,14,22H,3-5,10,13H2,1-2H3,(H,24,25) |
| InChIKey | SPSGEMTXCQNSEO-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 99.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.50 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |