C19H23N3O4S — CID 53056795
6-(azepan-1-yl)-5-[(4-methylphenyl)sulfonylamino]pyridine-3-carboxylic acid (PubChem CID 53056795) has the molecular formula C19H23N3O4S and a molecular weight of 389.48 g/mol. Its IUPAC name is 6-(azepan-1-yl)-5-[(4-methylphenyl)sulfonylamino]pyridine-3-carboxylic acid.
| Compound Name | 6-(azepan-1-yl)-5-[(4-methylphenyl)sulfonylamino]pyridine-3-carboxylic acid |
|---|---|
| PubChem CID | 53056795 |
| Molecular Formula | C19H23N3O4S |
| Molecular Weight | 389.48 g/mol |
| Exact Mass | 389.14 |
| IUPAC Name | 6-(azepan-1-yl)-5-[(4-methylphenyl)sulfonylamino]pyridine-3-carboxylic acid |
| SMILES | Cc1ccc(S(=O)(=O)Nc2cc(C(=O)O)cnc2N2CCCCCC2)cc1 |
| InChI | InChI=1S/C19H23N3O4S/c1-14-6-8-16(9-7-14)27(25,26)21-17-12-15(19(23)24)13-20-18(17)22-10-4-2-3-5-11-22/h6-9,12-13,21H,2-5,10-11H2,1H3,(H,23,24) |
| InChIKey | BXJLKLBZXGZBGN-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 99.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.48 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |