C21H25N3O3S2 — CID 53057168
2,5-dimethyl-N-[4-(4-methylpiperidin-1-yl)phenyl]-4-(1,2-oxazol-5-yl)thiophene-3-sulfonamide (PubChem CID 53057168) has the molecular formula C21H25N3O3S2 and a molecular weight of 431.58 g/mol. Its IUPAC name is 2,5-dimethyl-N-[4-(4-methylpiperidin-1-yl)phenyl]-4-(1,2-oxazol-5-yl)thiophene-3-sulfonamide.
| Compound Name | 2,5-dimethyl-N-[4-(4-methylpiperidin-1-yl)phenyl]-4-(1,2-oxazol-5-yl)thiophene-3-sulfonamide |
|---|---|
| PubChem CID | 53057168 |
| Molecular Formula | C21H25N3O3S2 |
| Molecular Weight | 431.58 g/mol |
| Exact Mass | 431.13 |
| IUPAC Name | 2,5-dimethyl-N-[4-(4-methylpiperidin-1-yl)phenyl]-4-(1,2-oxazol-5-yl)thiophene-3-sulfonamide |
| SMILES | Cc1sc(C)c(S(=O)(=O)Nc2ccc(N3CCC(C)CC3)cc2)c1-c1ccno1 |
| InChI | InChI=1S/C21H25N3O3S2/c1-14-9-12-24(13-10-14)18-6-4-17(5-7-18)23-29(25,26)21-16(3)28-15(2)20(21)19-8-11-22-27-19/h4-8,11,14,23H,9-10,12-13H2,1-3H3 |
| InChIKey | HBHKSCNKSUCRDK-UHFFFAOYSA-N |
| XLogP | 5.06 |
| TPSA | 75.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.58 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|