C17H28N2O4S — CID 53059325
ethyl 4-(cycloheptylsulfamoyl)-1,3,5-trimethylpyrrole-2-carboxylate (PubChem CID 53059325) has the molecular formula C17H28N2O4S and a molecular weight of 356.49 g/mol. Its IUPAC name is ethyl 4-(cycloheptylsulfamoyl)-1,3,5-trimethylpyrrole-2-carboxylate.
| Compound Name | ethyl 4-(cycloheptylsulfamoyl)-1,3,5-trimethylpyrrole-2-carboxylate |
|---|---|
| PubChem CID | 53059325 |
| Molecular Formula | C17H28N2O4S |
| Molecular Weight | 356.49 g/mol |
| Exact Mass | 356.18 |
| IUPAC Name | ethyl 4-(cycloheptylsulfamoyl)-1,3,5-trimethylpyrrole-2-carboxylate |
| SMILES | CCOC(=O)c1c(C)c(S(=O)(=O)NC2CCCCCC2)c(C)n1C |
| InChI | InChI=1S/C17H28N2O4S/c1-5-23-17(20)15-12(2)16(13(3)19(15)4)24(21,22)18-14-10-8-6-7-9-11-14/h14,18H,5-11H2,1-4H3 |
| InChIKey | NKHGDWLVPAJOIX-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 77.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.49 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |