C25H28N4O2 — CID 5306210
N-[2-(1-adamantyl)ethyl]-3-(4-pyrrol-1-ylphenyl)-1,2,4-oxadiazole-5-carboxamide (PubChem CID 5306210) has the molecular formula C25H28N4O2 and a molecular weight of 416.53 g/mol. Its IUPAC name is N-[2-(1-adamantyl)ethyl]-3-(4-pyrrol-1-ylphenyl)-1,2,4-oxadiazole-5-carboxamide.
| Compound Name | N-[2-(1-adamantyl)ethyl]-3-(4-pyrrol-1-ylphenyl)-1,2,4-oxadiazole-5-carboxamide |
|---|---|
| PubChem CID | 5306210 |
| Molecular Formula | C25H28N4O2 |
| Molecular Weight | 416.53 g/mol |
| Exact Mass | 416.22 |
| IUPAC Name | N-[2-(1-adamantyl)ethyl]-3-(4-pyrrol-1-ylphenyl)-1,2,4-oxadiazole-5-carboxamide |
| SMILES | O=C(NCCC12CC3CC(CC(C3)C1)C2)c1nc(-c2ccc(-n3cccc3)cc2)no1 |
| InChI | InChI=1S/C25H28N4O2/c30-23(26-8-7-25-14-17-11-18(15-25)13-19(12-17)16-25)24-27-22(28-31-24)20-3-5-21(6-4-20)29-9-1-2-10-29/h1-6,9-10,17-19H,7-8,11-16H2,(H,26,30) |
| InChIKey | ZPRLGUXQNNHJTC-UHFFFAOYSA-N |
| XLogP | 4.86 |
| TPSA | 72.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.53 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'pyrrole_G(4)', 'substructure': 'N/A'} |
|---|