C17H16F3N3O2S — CID 53063314
1-phenyl-N-[2-[2-(trifluoromethyl)benzimidazol-1-yl]ethyl]methanesulfonamide (PubChem CID 53063314) has the molecular formula C17H16F3N3O2S and a molecular weight of 383.40 g/mol. Its IUPAC name is 1-phenyl-N-[2-[2-(trifluoromethyl)benzimidazol-1-yl]ethyl]methanesulfonamide.
| Compound Name | 1-phenyl-N-[2-[2-(trifluoromethyl)benzimidazol-1-yl]ethyl]methanesulfonamide |
|---|---|
| PubChem CID | 53063314 |
| Molecular Formula | C17H16F3N3O2S |
| Molecular Weight | 383.40 g/mol |
| Exact Mass | 383.09 |
| IUPAC Name | 1-phenyl-N-[2-[2-(trifluoromethyl)benzimidazol-1-yl]ethyl]methanesulfonamide |
| SMILES | O=S(=O)(Cc1ccccc1)NCCn1c(C(F)(F)F)nc2ccccc21 |
| InChI | InChI=1S/C17H16F3N3O2S/c18-17(19,20)16-22-14-8-4-5-9-15(14)23(16)11-10-21-26(24,25)12-13-6-2-1-3-7-13/h1-9,21H,10-12H2 |
| InChIKey | GDESJJINNLSMJM-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 63.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.40 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |