C23H21ClN6O4 — CID 53063563
3-[3-[2-(4-chlorophenyl)-4-methyl-3,5-dioxo-1,2,4-triazin-6-yl]-1,2,4-oxadiazol-5-yl]-N-(2,3-dimethylphenyl)propanamide (PubChem CID 53063563) has the molecular formula C23H21ClN6O4 and a molecular weight of 480.91 g/mol. Its IUPAC name is 3-[3-[2-(4-chlorophenyl)-4-methyl-3,5-dioxo-1,2,4-triazin-6-yl]-1,2,4-oxadiazol-5-yl]-N-(2,3-dimethylphenyl)propanamide.
| Compound Name | 3-[3-[2-(4-chlorophenyl)-4-methyl-3,5-dioxo-1,2,4-triazin-6-yl]-1,2,4-oxadiazol-5-yl]-N-(2,3-dimethylphenyl)propanamide |
|---|---|
| PubChem CID | 53063563 |
| Molecular Formula | C23H21ClN6O4 |
| Molecular Weight | 480.91 g/mol |
| Exact Mass | 480.13 |
| IUPAC Name | 3-[3-[2-(4-chlorophenyl)-4-methyl-3,5-dioxo-1,2,4-triazin-6-yl]-1,2,4-oxadiazol-5-yl]-N-(2,3-dimethylphenyl)propanamide |
| SMILES | Cc1cccc(NC(=O)CCc2nc(-c3nn(-c4ccc(Cl)cc4)c(=O)n(C)c3=O)no2)c1C |
| InChI | InChI=1S/C23H21ClN6O4/c1-13-5-4-6-17(14(13)2)25-18(31)11-12-19-26-21(28-34-19)20-22(32)29(3)23(33)30(27-20)16-9-7-15(24)8-10-16/h4-10H,11-12H2,1-3H3,(H,25,31) |
| InChIKey | ZSIASTJRGLXWIQ-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 124.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.91 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |