C24H23ClN6O4 — CID 53063567
3-[3-[2-(4-chlorophenyl)-4-methyl-3,5-dioxo-1,2,4-triazin-6-yl]-1,2,4-oxadiazol-5-yl]-N-(3-phenylpropyl)propanamide (PubChem CID 53063567) has the molecular formula C24H23ClN6O4 and a molecular weight of 494.94 g/mol. Its IUPAC name is 3-[3-[2-(4-chlorophenyl)-4-methyl-3,5-dioxo-1,2,4-triazin-6-yl]-1,2,4-oxadiazol-5-yl]-N-(3-phenylpropyl)propanamide.
| Compound Name | 3-[3-[2-(4-chlorophenyl)-4-methyl-3,5-dioxo-1,2,4-triazin-6-yl]-1,2,4-oxadiazol-5-yl]-N-(3-phenylpropyl)propanamide |
|---|---|
| PubChem CID | 53063567 |
| Molecular Formula | C24H23ClN6O4 |
| Molecular Weight | 494.94 g/mol |
| Exact Mass | 494.15 |
| IUPAC Name | 3-[3-[2-(4-chlorophenyl)-4-methyl-3,5-dioxo-1,2,4-triazin-6-yl]-1,2,4-oxadiazol-5-yl]-N-(3-phenylpropyl)propanamide |
| SMILES | Cn1c(=O)c(-c2noc(CCC(=O)NCCCc3ccccc3)n2)nn(-c2ccc(Cl)cc2)c1=O |
| InChI | InChI=1S/C24H23ClN6O4/c1-30-23(33)21(28-31(24(30)34)18-11-9-17(25)10-12-18)22-27-20(35-29-22)14-13-19(32)26-15-5-8-16-6-3-2-4-7-16/h2-4,6-7,9-12H,5,8,13-15H2,1H3,(H,26,32) |
| InChIKey | XIUQUBGVKCRXOP-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 124.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.94 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|