C23H27N3O6 — CID 53063800
2-[4-[(4-methylphenyl)methyl]-2,3-dioxopiperazin-1-yl]-N-(3,4,5-trimethoxyphenyl)acetamide (PubChem CID 53063800) has the molecular formula C23H27N3O6 and a molecular weight of 441.48 g/mol. Its IUPAC name is 2-[4-[(4-methylphenyl)methyl]-2,3-dioxopiperazin-1-yl]-N-(3,4,5-trimethoxyphenyl)acetamide.
| Compound Name | 2-[4-[(4-methylphenyl)methyl]-2,3-dioxopiperazin-1-yl]-N-(3,4,5-trimethoxyphenyl)acetamide |
|---|---|
| PubChem CID | 53063800 |
| Molecular Formula | C23H27N3O6 |
| Molecular Weight | 441.48 g/mol |
| Exact Mass | 441.19 |
| IUPAC Name | 2-[4-[(4-methylphenyl)methyl]-2,3-dioxopiperazin-1-yl]-N-(3,4,5-trimethoxyphenyl)acetamide |
| SMILES | COc1cc(NC(=O)CN2CCN(Cc3ccc(C)cc3)C(=O)C2=O)cc(OC)c1OC |
| InChI | InChI=1S/C23H27N3O6/c1-15-5-7-16(8-6-15)13-25-9-10-26(23(29)22(25)28)14-20(27)24-17-11-18(30-2)21(32-4)19(12-17)31-3/h5-8,11-12H,9-10,13-14H2,1-4H3,(H,24,27) |
| InChIKey | QTFHZERIYMTUDN-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 97.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.48 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|