C22H25N3O5S — CID 53065052
2-ethyl-6-[4-(2-methylbenzoyl)piperazin-1-yl]sulfonyl-4H-1,4-benzoxazin-3-one (PubChem CID 53065052) has the molecular formula C22H25N3O5S and a molecular weight of 443.53 g/mol. Its IUPAC name is 2-ethyl-6-[4-(2-methylbenzoyl)piperazin-1-yl]sulfonyl-4H-1,4-benzoxazin-3-one.
| Compound Name | 2-ethyl-6-[4-(2-methylbenzoyl)piperazin-1-yl]sulfonyl-4H-1,4-benzoxazin-3-one |
|---|---|
| PubChem CID | 53065052 |
| Molecular Formula | C22H25N3O5S |
| Molecular Weight | 443.53 g/mol |
| Exact Mass | 443.15 |
| IUPAC Name | 2-ethyl-6-[4-(2-methylbenzoyl)piperazin-1-yl]sulfonyl-4H-1,4-benzoxazin-3-one |
| SMILES | CCC1Oc2ccc(S(=O)(=O)N3CCN(C(=O)c4ccccc4C)CC3)cc2NC1=O |
| InChI | InChI=1S/C22H25N3O5S/c1-3-19-21(26)23-18-14-16(8-9-20(18)30-19)31(28,29)25-12-10-24(11-13-25)22(27)17-7-5-4-6-15(17)2/h4-9,14,19H,3,10-13H2,1-2H3,(H,23,26) |
| InChIKey | WMDUUOWNMWJNPA-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 96.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.53 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |