C21H22FN3O5S — CID 95067623
(2S)-2-ethyl-6-[4-(4-fluorobenzoyl)piperazin-1-yl]sulfonyl-4H-1,4-benzoxazin-3-one (PubChem CID 95067623) has the molecular formula C21H22FN3O5S and a molecular weight of 447.49 g/mol. Its IUPAC name is (2S)-2-ethyl-6-[4-(4-fluorobenzoyl)piperazin-1-yl]sulfonyl-4H-1,4-benzoxazin-3-one.
| Compound Name | (2S)-2-ethyl-6-[4-(4-fluorobenzoyl)piperazin-1-yl]sulfonyl-4H-1,4-benzoxazin-3-one |
|---|---|
| PubChem CID | 95067623 |
| Molecular Formula | C21H22FN3O5S |
| Molecular Weight | 447.49 g/mol |
| Exact Mass | 447.13 |
| IUPAC Name | (2S)-2-ethyl-6-[4-(4-fluorobenzoyl)piperazin-1-yl]sulfonyl-4H-1,4-benzoxazin-3-one |
| SMILES | CC[C@@H]1Oc2ccc(S(=O)(=O)N3CCN(C(=O)c4ccc(F)cc4)CC3)cc2NC1=O |
| InChI | InChI=1S/C21H22FN3O5S/c1-2-18-20(26)23-17-13-16(7-8-19(17)30-18)31(28,29)25-11-9-24(10-12-25)21(27)14-3-5-15(22)6-4-14/h3-8,13,18H,2,9-12H2,1H3,(H,23,26)/t18-/m0/s1 |
| InChIKey | CZOURJWULZMGNP-SFHVURJKSA-N |
| XLogP | 2.08 |
| TPSA | 96.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.49 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |