C15H24N2O4S — CID 53069155
ethyl 4-(azepan-1-ylsulfonyl)-1,5-dimethylpyrrole-2-carboxylate (PubChem CID 53069155) has the molecular formula C15H24N2O4S and a molecular weight of 328.43 g/mol. Its IUPAC name is ethyl 4-(azepan-1-ylsulfonyl)-1,5-dimethylpyrrole-2-carboxylate.
| Compound Name | ethyl 4-(azepan-1-ylsulfonyl)-1,5-dimethylpyrrole-2-carboxylate |
|---|---|
| PubChem CID | 53069155 |
| Molecular Formula | C15H24N2O4S |
| Molecular Weight | 328.43 g/mol |
| Exact Mass | 328.15 |
| IUPAC Name | ethyl 4-(azepan-1-ylsulfonyl)-1,5-dimethylpyrrole-2-carboxylate |
| SMILES | CCOC(=O)c1cc(S(=O)(=O)N2CCCCCC2)c(C)n1C |
| InChI | InChI=1S/C15H24N2O4S/c1-4-21-15(18)13-11-14(12(2)16(13)3)22(19,20)17-9-7-5-6-8-10-17/h11H,4-10H2,1-3H3 |
| InChIKey | CDEDFXKUIZOPKF-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 68.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.43 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |