C11H18N2O4S — CID 53069179
ethyl 4-(ethylsulfamoyl)-1,5-dimethylpyrrole-2-carboxylate (PubChem CID 53069179) has the molecular formula C11H18N2O4S and a molecular weight of 274.34 g/mol. Its IUPAC name is ethyl 4-(ethylsulfamoyl)-1,5-dimethylpyrrole-2-carboxylate.
| Compound Name | ethyl 4-(ethylsulfamoyl)-1,5-dimethylpyrrole-2-carboxylate |
|---|---|
| PubChem CID | 53069179 |
| Molecular Formula | C11H18N2O4S |
| Molecular Weight | 274.34 g/mol |
| Exact Mass | 274.10 |
| IUPAC Name | ethyl 4-(ethylsulfamoyl)-1,5-dimethylpyrrole-2-carboxylate |
| SMILES | CCNS(=O)(=O)c1cc(C(=O)OCC)n(C)c1C |
| InChI | InChI=1S/C11H18N2O4S/c1-5-12-18(15,16)10-7-9(11(14)17-6-2)13(4)8(10)3/h7,12H,5-6H2,1-4H3 |
| InChIKey | BFMKKHLKVXMMJA-UHFFFAOYSA-N |
| XLogP | 0.81 |
| TPSA | 77.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.34 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |