C21H21FN4O3 — CID 53070624
1-[1-(3-fluorophenyl)-6-oxopyridazin-3-yl]-N-(furan-2-ylmethyl)piperidine-4-carboxamide (PubChem CID 53070624) has the molecular formula C21H21FN4O3 and a molecular weight of 396.42 g/mol. Its IUPAC name is 1-[1-(3-fluorophenyl)-6-oxopyridazin-3-yl]-N-(furan-2-ylmethyl)piperidine-4-carboxamide.
| Compound Name | 1-[1-(3-fluorophenyl)-6-oxopyridazin-3-yl]-N-(furan-2-ylmethyl)piperidine-4-carboxamide |
|---|---|
| PubChem CID | 53070624 |
| Molecular Formula | C21H21FN4O3 |
| Molecular Weight | 396.42 g/mol |
| Exact Mass | 396.16 |
| IUPAC Name | 1-[1-(3-fluorophenyl)-6-oxopyridazin-3-yl]-N-(furan-2-ylmethyl)piperidine-4-carboxamide |
| SMILES | O=C(NCc1ccco1)C1CCN(c2ccc(=O)n(-c3cccc(F)c3)n2)CC1 |
| InChI | InChI=1S/C21H21FN4O3/c22-16-3-1-4-17(13-16)26-20(27)7-6-19(24-26)25-10-8-15(9-11-25)21(28)23-14-18-5-2-12-29-18/h1-7,12-13,15H,8-11,14H2,(H,23,28) |
| InChIKey | ZFYXCRVRRSTCON-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 80.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.42 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |