C20H19N5O4S — CID 53071585
2-[3-(5-ethyl-1,3,4-oxadiazol-2-yl)indol-1-yl]-N-(4-sulfamoylphenyl)acetamide (PubChem CID 53071585) has the molecular formula C20H19N5O4S and a molecular weight of 425.47 g/mol. Its IUPAC name is 2-[3-(5-ethyl-1,3,4-oxadiazol-2-yl)indol-1-yl]-N-(4-sulfamoylphenyl)acetamide.
| Compound Name | 2-[3-(5-ethyl-1,3,4-oxadiazol-2-yl)indol-1-yl]-N-(4-sulfamoylphenyl)acetamide |
|---|---|
| PubChem CID | 53071585 |
| Molecular Formula | C20H19N5O4S |
| Molecular Weight | 425.47 g/mol |
| Exact Mass | 425.12 |
| IUPAC Name | 2-[3-(5-ethyl-1,3,4-oxadiazol-2-yl)indol-1-yl]-N-(4-sulfamoylphenyl)acetamide |
| SMILES | CCc1nnc(-c2cn(CC(=O)Nc3ccc(S(N)(=O)=O)cc3)c3ccccc23)o1 |
| InChI | InChI=1S/C20H19N5O4S/c1-2-19-23-24-20(29-19)16-11-25(17-6-4-3-5-15(16)17)12-18(26)22-13-7-9-14(10-8-13)30(21,27)28/h3-11H,2,12H2,1H3,(H,22,26)(H2,21,27,28) |
| InChIKey | VNROPPNICJQOLK-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 133.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.47 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |