C19H16ClN3O5S — CID 53073409
2-[3-(4-chlorophenyl)sulfonyl-6-oxopyridazin-1-yl]-N-(4-methoxyphenyl)acetamide (PubChem CID 53073409) has the molecular formula C19H16ClN3O5S and a molecular weight of 433.87 g/mol. Its IUPAC name is 2-[3-(4-chlorophenyl)sulfonyl-6-oxopyridazin-1-yl]-N-(4-methoxyphenyl)acetamide.
| Compound Name | 2-[3-(4-chlorophenyl)sulfonyl-6-oxopyridazin-1-yl]-N-(4-methoxyphenyl)acetamide |
|---|---|
| PubChem CID | 53073409 |
| Molecular Formula | C19H16ClN3O5S |
| Molecular Weight | 433.87 g/mol |
| Exact Mass | 433.05 |
| IUPAC Name | 2-[3-(4-chlorophenyl)sulfonyl-6-oxopyridazin-1-yl]-N-(4-methoxyphenyl)acetamide |
| SMILES | COc1ccc(NC(=O)Cn2nc(S(=O)(=O)c3ccc(Cl)cc3)ccc2=O)cc1 |
| InChI | InChI=1S/C19H16ClN3O5S/c1-28-15-6-4-14(5-7-15)21-17(24)12-23-19(25)11-10-18(22-23)29(26,27)16-8-2-13(20)3-9-16/h2-11H,12H2,1H3,(H,21,24) |
| InChIKey | CNCRNCIYODJFGC-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 107.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.87 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |