C17H16N4O2S — CID 53074572
8-[(4-ethylphenyl)methyl]-11-methyl-5-thia-1,8,10,11-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),3,9-triene-7,12-dione (PubChem CID 53074572) has the molecular formula C17H16N4O2S and a molecular weight of 340.41 g/mol. Its IUPAC name is 8-[(4-ethylphenyl)methyl]-11-methyl-5-thia-1,8,10,11-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),3,9-triene-7,12-dione.
| Compound Name | 8-[(4-ethylphenyl)methyl]-11-methyl-5-thia-1,8,10,11-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),3,9-triene-7,12-dione |
|---|---|
| PubChem CID | 53074572 |
| Molecular Formula | C17H16N4O2S |
| Molecular Weight | 340.41 g/mol |
| Exact Mass | 340.10 |
| IUPAC Name | 8-[(4-ethylphenyl)methyl]-11-methyl-5-thia-1,8,10,11-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),3,9-triene-7,12-dione |
| SMILES | CCc1ccc(Cn2c(=O)c3sccc3n3c(=O)n(C)nc23)cc1 |
| InChI | InChI=1S/C17H16N4O2S/c1-3-11-4-6-12(7-5-11)10-20-15(22)14-13(8-9-24-14)21-16(20)18-19(2)17(21)23/h4-9H,3,10H2,1-2H3 |
| InChIKey | MCDYBCXCQOMIFT-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 61.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.41 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |