C24H20ClFN4O3S — CID 53074593
11-[(2-chloro-6-fluorophenyl)methyl]-8-[(4-propoxyphenyl)methyl]-5-thia-1,8,10,11-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),3,9-triene-7,12-dione (PubChem CID 53074593) has the molecular formula C24H20ClFN4O3S and a molecular weight of 498.97 g/mol. Its IUPAC name is 11-[(2-chloro-6-fluorophenyl)methyl]-8-[(4-propoxyphenyl)methyl]-5-thia-1,8,10,11-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),3,9-triene-7,12-dione.
| Compound Name | 11-[(2-chloro-6-fluorophenyl)methyl]-8-[(4-propoxyphenyl)methyl]-5-thia-1,8,10,11-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),3,9-triene-7,12-dione |
|---|---|
| PubChem CID | 53074593 |
| Molecular Formula | C24H20ClFN4O3S |
| Molecular Weight | 498.97 g/mol |
| Exact Mass | 498.09 |
| IUPAC Name | 11-[(2-chloro-6-fluorophenyl)methyl]-8-[(4-propoxyphenyl)methyl]-5-thia-1,8,10,11-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),3,9-triene-7,12-dione |
| SMILES | CCCOc1ccc(Cn2c(=O)c3sccc3n3c(=O)n(Cc4c(F)cccc4Cl)nc23)cc1 |
| InChI | InChI=1S/C24H20ClFN4O3S/c1-2-11-33-16-8-6-15(7-9-16)13-28-22(31)21-20(10-12-34-21)30-23(28)27-29(24(30)32)14-17-18(25)4-3-5-19(17)26/h3-10,12H,2,11,13-14H2,1H3 |
| InChIKey | IGRVFEYLCCQRCO-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 70.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.97 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |