About N-cyclopentyl-5-propyl-1,2-oxazole-3-carboxamide
N-cyclopentyl-5-propyl-1,2-oxazole-3-carboxamide (PubChem CID 5307778) has the molecular formula C12H18N2O2
and a molecular weight of 222.29 g/mol. Its IUPAC name is N-cyclopentyl-5-propyl-1,2-oxazole-3-carboxamide.
Molecular Properties
| Compound Name | N-cyclopentyl-5-propyl-1,2-oxazole-3-carboxamide |
| PubChem CID | 5307778 |
| Molecular Formula | C12H18N2O2 |
| Molecular Weight | 222.29 g/mol |
| Exact Mass | 222.14 |
| IUPAC Name | N-cyclopentyl-5-propyl-1,2-oxazole-3-carboxamide |
| SMILES | CCCc1cc(C(=O)NC2CCCC2)no1 |
| InChI | InChI=1S/C12H18N2O2/c1-2-5-10-8-11(14-16-10)12(15)13-9-6-3-4-7-9/h8-9H,2-7H2,1H3,(H,13,15) |
| InChIKey | ZLDZYFPXAGDKKU-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 55.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 222.29 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-cyclopentyl-5-propyl-1,2-oxazole-3-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-cyclopentyl-5-propyl-1,2-oxazole-3-carboxamide?
The IUPAC name of N-cyclopentyl-5-propyl-1,2-oxazole-3-carboxamide (CID 5307778) is N-cyclopentyl-5-propyl-1,2-oxazole-3-carboxamide.
What is the SMILES notation for N-cyclopentyl-5-propyl-1,2-oxazole-3-carboxamide?
The canonical SMILES for N-cyclopentyl-5-propyl-1,2-oxazole-3-carboxamide is CCCc1cc(C(=O)NC2CCCC2)no1.
What is the InChIKey of N-cyclopentyl-5-propyl-1,2-oxazole-3-carboxamide?
The InChIKey is ZLDZYFPXAGDKKU-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H18N2O2/c1-2-5-10-8-11(14-16-10)12(15)13-9-6-3-4-7-9/h8-9H,2-7H2,1H3,(H,13,15).
What are the key properties of N-cyclopentyl-5-propyl-1,2-oxazole-3-carboxamide?
N-cyclopentyl-5-propyl-1,2-oxazole-3-carboxamide has a molecular weight of 222.29 g/mol, XLogP of 2.30, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-cyclopentyl-5-propyl-1,2-oxazole-3-carboxamide is sourced from PubChem (CID 5307778), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).