C21H26N4O2S — CID 5307923
5-methyl-N-[3-(4-methylpiperazin-1-yl)propyl]-4-oxothieno[3,2-c]quinoline-2-carboxamide (PubChem CID 5307923) has the molecular formula C21H26N4O2S and a molecular weight of 398.53 g/mol. Its IUPAC name is 5-methyl-N-[3-(4-methylpiperazin-1-yl)propyl]-4-oxothieno[3,2-c]quinoline-2-carboxamide.
| Compound Name | 5-methyl-N-[3-(4-methylpiperazin-1-yl)propyl]-4-oxothieno[3,2-c]quinoline-2-carboxamide |
|---|---|
| PubChem CID | 5307923 |
| Molecular Formula | C21H26N4O2S |
| Molecular Weight | 398.53 g/mol |
| Exact Mass | 398.18 |
| IUPAC Name | 5-methyl-N-[3-(4-methylpiperazin-1-yl)propyl]-4-oxothieno[3,2-c]quinoline-2-carboxamide |
| SMILES | CN1CCN(CCCNC(=O)c2cc3c(=O)n(C)c4ccccc4c3s2)CC1 |
| InChI | InChI=1S/C21H26N4O2S/c1-23-10-12-25(13-11-23)9-5-8-22-20(26)18-14-16-19(28-18)15-6-3-4-7-17(15)24(2)21(16)27/h3-4,6-7,14H,5,8-13H2,1-2H3,(H,22,26) |
| InChIKey | MWHCTKCXRCXLMX-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 57.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.53 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|