C18H20FN5OS — CID 53080018
N-tert-butyl-4-(4-fluorophenyl)-7-thia-2,3,5,10-tetrazatricyclo[6.4.0.02,6]dodeca-1(8),3,5-triene-10-carboxamide (PubChem CID 53080018) has the molecular formula C18H20FN5OS and a molecular weight of 373.46 g/mol. Its IUPAC name is N-tert-butyl-4-(4-fluorophenyl)-7-thia-2,3,5,10-tetrazatricyclo[6.4.0.02,6]dodeca-1(8),3,5-triene-10-carboxamide.
| Compound Name | N-tert-butyl-4-(4-fluorophenyl)-7-thia-2,3,5,10-tetrazatricyclo[6.4.0.02,6]dodeca-1(8),3,5-triene-10-carboxamide |
|---|---|
| PubChem CID | 53080018 |
| Molecular Formula | C18H20FN5OS |
| Molecular Weight | 373.46 g/mol |
| Exact Mass | 373.14 |
| IUPAC Name | N-tert-butyl-4-(4-fluorophenyl)-7-thia-2,3,5,10-tetrazatricyclo[6.4.0.02,6]dodeca-1(8),3,5-triene-10-carboxamide |
| SMILES | CC(C)(C)NC(=O)N1CCc2c(sc3nc(-c4ccc(F)cc4)nn23)C1 |
| InChI | InChI=1S/C18H20FN5OS/c1-18(2,3)21-16(25)23-9-8-13-14(10-23)26-17-20-15(22-24(13)17)11-4-6-12(19)7-5-11/h4-7H,8-10H2,1-3H3,(H,21,25) |
| InChIKey | LWGMAGAUNKDNNU-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 62.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.46 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |