C19H21N5OS2 — CID 653847
2-[(4-ethyl-5-phenyl-1,2,4-triazol-3-yl)sulfanyl]-N-(4,5,6,7-tetrahydro-1,3-benzothiazol-2-yl)acetamide (PubChem CID 653847) has the molecular formula C19H21N5OS2 and a molecular weight of 399.55 g/mol. Its IUPAC name is 2-[(4-ethyl-5-phenyl-1,2,4-triazol-3-yl)sulfanyl]-N-(4,5,6,7-tetrahydro-1,3-benzothiazol-2-yl)acetamide.
| Compound Name | 2-[(4-ethyl-5-phenyl-1,2,4-triazol-3-yl)sulfanyl]-N-(4,5,6,7-tetrahydro-1,3-benzothiazol-2-yl)acetamide |
|---|---|
| PubChem CID | 653847 |
| Molecular Formula | C19H21N5OS2 |
| Molecular Weight | 399.55 g/mol |
| Exact Mass | 399.12 |
| IUPAC Name | 2-[(4-ethyl-5-phenyl-1,2,4-triazol-3-yl)sulfanyl]-N-(4,5,6,7-tetrahydro-1,3-benzothiazol-2-yl)acetamide |
| SMILES | CCn1c(SCC(=O)Nc2nc3c(s2)CCCC3)nnc1-c1ccccc1 |
| InChI | InChI=1S/C19H21N5OS2/c1-2-24-17(13-8-4-3-5-9-13)22-23-19(24)26-12-16(25)21-18-20-14-10-6-7-11-15(14)27-18/h3-5,8-9H,2,6-7,10-12H2,1H3,(H,20,21,25) |
| InChIKey | BJVSPPLJHWTYJL-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 72.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.55 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |