C19H22N4O6S — CID 53080787
5-[1-(3,5-dimethyl-1,2-oxazol-4-yl)-6-oxopyridazin-3-yl]-2-methoxy-N-(2-methoxyethyl)benzenesulfonamide (PubChem CID 53080787) has the molecular formula C19H22N4O6S and a molecular weight of 434.47 g/mol. Its IUPAC name is 5-[1-(3,5-dimethyl-1,2-oxazol-4-yl)-6-oxopyridazin-3-yl]-2-methoxy-N-(2-methoxyethyl)benzenesulfonamide.
| Compound Name | 5-[1-(3,5-dimethyl-1,2-oxazol-4-yl)-6-oxopyridazin-3-yl]-2-methoxy-N-(2-methoxyethyl)benzenesulfonamide |
|---|---|
| PubChem CID | 53080787 |
| Molecular Formula | C19H22N4O6S |
| Molecular Weight | 434.47 g/mol |
| Exact Mass | 434.13 |
| IUPAC Name | 5-[1-(3,5-dimethyl-1,2-oxazol-4-yl)-6-oxopyridazin-3-yl]-2-methoxy-N-(2-methoxyethyl)benzenesulfonamide |
| SMILES | COCCNS(=O)(=O)c1cc(-c2ccc(=O)n(-c3c(C)noc3C)n2)ccc1OC |
| InChI | InChI=1S/C19H22N4O6S/c1-12-19(13(2)29-22-12)23-18(24)8-6-15(21-23)14-5-7-16(28-4)17(11-14)30(25,26)20-9-10-27-3/h5-8,11,20H,9-10H2,1-4H3 |
| InChIKey | YVGREOSTMSIPKO-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 125.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.47 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|