C20H24N4O4 — CID 53081250
5-(3,5-dimethyl-1-benzofuran-2-yl)-N-(3-morpholin-4-ylpropyl)-1,3,4-oxadiazole-2-carboxamide (PubChem CID 53081250) has the molecular formula C20H24N4O4 and a molecular weight of 384.44 g/mol. Its IUPAC name is 5-(3,5-dimethyl-1-benzofuran-2-yl)-N-(3-morpholin-4-ylpropyl)-1,3,4-oxadiazole-2-carboxamide.
| Compound Name | 5-(3,5-dimethyl-1-benzofuran-2-yl)-N-(3-morpholin-4-ylpropyl)-1,3,4-oxadiazole-2-carboxamide |
|---|---|
| PubChem CID | 53081250 |
| Molecular Formula | C20H24N4O4 |
| Molecular Weight | 384.44 g/mol |
| Exact Mass | 384.18 |
| IUPAC Name | 5-(3,5-dimethyl-1-benzofuran-2-yl)-N-(3-morpholin-4-ylpropyl)-1,3,4-oxadiazole-2-carboxamide |
| SMILES | Cc1ccc2oc(-c3nnc(C(=O)NCCCN4CCOCC4)o3)c(C)c2c1 |
| InChI | InChI=1S/C20H24N4O4/c1-13-4-5-16-15(12-13)14(2)17(27-16)19-22-23-20(28-19)18(25)21-6-3-7-24-8-10-26-11-9-24/h4-5,12H,3,6-11H2,1-2H3,(H,21,25) |
| InChIKey | PFDLATFAVYFHOJ-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 93.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.44 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|