C19H23N5O5 — CID 53130507
3-[(5-methyl-2-oxo-1,3-benzoxazol-3-yl)methyl]-N-(3-morpholin-4-ylpropyl)-1,2,4-oxadiazole-5-carboxamide (PubChem CID 53130507) has the molecular formula C19H23N5O5 and a molecular weight of 401.42 g/mol. Its IUPAC name is 3-[(5-methyl-2-oxo-1,3-benzoxazol-3-yl)methyl]-N-(3-morpholin-4-ylpropyl)-1,2,4-oxadiazole-5-carboxamide.
| Compound Name | 3-[(5-methyl-2-oxo-1,3-benzoxazol-3-yl)methyl]-N-(3-morpholin-4-ylpropyl)-1,2,4-oxadiazole-5-carboxamide |
|---|---|
| PubChem CID | 53130507 |
| Molecular Formula | C19H23N5O5 |
| Molecular Weight | 401.42 g/mol |
| Exact Mass | 401.17 |
| IUPAC Name | 3-[(5-methyl-2-oxo-1,3-benzoxazol-3-yl)methyl]-N-(3-morpholin-4-ylpropyl)-1,2,4-oxadiazole-5-carboxamide |
| SMILES | Cc1ccc2oc(=O)n(Cc3noc(C(=O)NCCCN4CCOCC4)n3)c2c1 |
| InChI | InChI=1S/C19H23N5O5/c1-13-3-4-15-14(11-13)24(19(26)28-15)12-16-21-18(29-22-16)17(25)20-5-2-6-23-7-9-27-10-8-23/h3-4,11H,2,5-10,12H2,1H3,(H,20,25) |
| InChIKey | UUTKMPDXEASOOH-UHFFFAOYSA-N |
| XLogP | 0.79 |
| TPSA | 115.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.42 |
| LogP ≤ 5 | 0.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|