C18H22N2O4S2 — CID 53083707
5-acetyl-N-[3-(furan-2-yl)propyl]-3,4-dihydro-2H-1,5-benzothiazepine-7-sulfonamide (PubChem CID 53083707) has the molecular formula C18H22N2O4S2 and a molecular weight of 394.52 g/mol. Its IUPAC name is 5-acetyl-N-[3-(furan-2-yl)propyl]-3,4-dihydro-2H-1,5-benzothiazepine-7-sulfonamide.
| Compound Name | 5-acetyl-N-[3-(furan-2-yl)propyl]-3,4-dihydro-2H-1,5-benzothiazepine-7-sulfonamide |
|---|---|
| PubChem CID | 53083707 |
| Molecular Formula | C18H22N2O4S2 |
| Molecular Weight | 394.52 g/mol |
| Exact Mass | 394.10 |
| IUPAC Name | 5-acetyl-N-[3-(furan-2-yl)propyl]-3,4-dihydro-2H-1,5-benzothiazepine-7-sulfonamide |
| SMILES | CC(=O)N1CCCSc2ccc(S(=O)(=O)NCCCc3ccco3)cc21 |
| InChI | InChI=1S/C18H22N2O4S2/c1-14(21)20-10-4-12-25-18-8-7-16(13-17(18)20)26(22,23)19-9-2-5-15-6-3-11-24-15/h3,6-8,11,13,19H,2,4-5,9-10,12H2,1H3 |
| InChIKey | BEUGCQUWGARPOH-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 79.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.52 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|