C22H17BrFN3O — CID 53084695
N-[(3-bromophenyl)methyl]-1-[(4-fluorophenyl)methyl]indazole-6-carboxamide (PubChem CID 53084695) has the molecular formula C22H17BrFN3O and a molecular weight of 438.30 g/mol. Its IUPAC name is N-[(3-bromophenyl)methyl]-1-[(4-fluorophenyl)methyl]indazole-6-carboxamide.
| Compound Name | N-[(3-bromophenyl)methyl]-1-[(4-fluorophenyl)methyl]indazole-6-carboxamide |
|---|---|
| PubChem CID | 53084695 |
| Molecular Formula | C22H17BrFN3O |
| Molecular Weight | 438.30 g/mol |
| Exact Mass | 437.05 |
| IUPAC Name | N-[(3-bromophenyl)methyl]-1-[(4-fluorophenyl)methyl]indazole-6-carboxamide |
| SMILES | O=C(NCc1cccc(Br)c1)c1ccc2cnn(Cc3ccc(F)cc3)c2c1 |
| InChI | InChI=1S/C22H17BrFN3O/c23-19-3-1-2-16(10-19)12-25-22(28)17-6-7-18-13-26-27(21(18)11-17)14-15-4-8-20(24)9-5-15/h1-11,13H,12,14H2,(H,25,28) |
| InChIKey | CCBXFXWUKPFHPH-UHFFFAOYSA-N |
| XLogP | 4.92 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.30 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |