C25H24FN3O — CID 95073148
1-[(4-fluorophenyl)methyl]-N-[(2R)-4-phenylbutan-2-yl]indazole-6-carboxamide (PubChem CID 95073148) has the molecular formula C25H24FN3O and a molecular weight of 401.49 g/mol. Its IUPAC name is 1-[(4-fluorophenyl)methyl]-N-[(2R)-4-phenylbutan-2-yl]indazole-6-carboxamide.
| Compound Name | 1-[(4-fluorophenyl)methyl]-N-[(2R)-4-phenylbutan-2-yl]indazole-6-carboxamide |
|---|---|
| PubChem CID | 95073148 |
| Molecular Formula | C25H24FN3O |
| Molecular Weight | 401.49 g/mol |
| Exact Mass | 401.19 |
| IUPAC Name | 1-[(4-fluorophenyl)methyl]-N-[(2R)-4-phenylbutan-2-yl]indazole-6-carboxamide |
| SMILES | C[C@H](CCc1ccccc1)NC(=O)c1ccc2cnn(Cc3ccc(F)cc3)c2c1 |
| InChI | InChI=1S/C25H24FN3O/c1-18(7-8-19-5-3-2-4-6-19)28-25(30)21-11-12-22-16-27-29(24(22)15-21)17-20-9-13-23(26)14-10-20/h2-6,9-16,18H,7-8,17H2,1H3,(H,28,30)/t18-/m1/s1 |
| InChIKey | DBQDKBZYNBVDLT-GOSISDBHSA-N |
| XLogP | 4.97 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.49 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |