C21H18ClN3OS — CID 53084774
1-[(3-chlorophenyl)methyl]-N-(2-thiophen-2-ylethyl)indazole-6-carboxamide (PubChem CID 53084774) has the molecular formula C21H18ClN3OS and a molecular weight of 395.92 g/mol. Its IUPAC name is 1-[(3-chlorophenyl)methyl]-N-(2-thiophen-2-ylethyl)indazole-6-carboxamide.
| Compound Name | 1-[(3-chlorophenyl)methyl]-N-(2-thiophen-2-ylethyl)indazole-6-carboxamide |
|---|---|
| PubChem CID | 53084774 |
| Molecular Formula | C21H18ClN3OS |
| Molecular Weight | 395.92 g/mol |
| Exact Mass | 395.09 |
| IUPAC Name | 1-[(3-chlorophenyl)methyl]-N-(2-thiophen-2-ylethyl)indazole-6-carboxamide |
| SMILES | O=C(NCCc1cccs1)c1ccc2cnn(Cc3cccc(Cl)c3)c2c1 |
| InChI | InChI=1S/C21H18ClN3OS/c22-18-4-1-3-15(11-18)14-25-20-12-16(6-7-17(20)13-24-25)21(26)23-9-8-19-5-2-10-27-19/h1-7,10-13H,8-9,14H2,(H,23,26) |
| InChIKey | HWODDHMDWJQZIG-UHFFFAOYSA-N |
| XLogP | 4.77 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.92 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |