C24H27N5O2 — CID 53087727
(4-tert-butylphenyl)-[4-(3-pyridin-4-yl-1H-pyrazole-5-carbonyl)piperazin-1-yl]methanone (PubChem CID 53087727) has the molecular formula C24H27N5O2 and a molecular weight of 417.51 g/mol. Its IUPAC name is (4-tert-butylphenyl)-[4-(3-pyridin-4-yl-1H-pyrazole-5-carbonyl)piperazin-1-yl]methanone.
| Compound Name | (4-tert-butylphenyl)-[4-(3-pyridin-4-yl-1H-pyrazole-5-carbonyl)piperazin-1-yl]methanone |
|---|---|
| PubChem CID | 53087727 |
| Molecular Formula | C24H27N5O2 |
| Molecular Weight | 417.51 g/mol |
| Exact Mass | 417.22 |
| IUPAC Name | (4-tert-butylphenyl)-[4-(3-pyridin-4-yl-1H-pyrazole-5-carbonyl)piperazin-1-yl]methanone |
| SMILES | CC(C)(C)c1ccc(C(=O)N2CCN(C(=O)c3cc(-c4ccncc4)n[nH]3)CC2)cc1 |
| InChI | InChI=1S/C24H27N5O2/c1-24(2,3)19-6-4-18(5-7-19)22(30)28-12-14-29(15-13-28)23(31)21-16-20(26-27-21)17-8-10-25-11-9-17/h4-11,16H,12-15H2,1-3H3,(H,26,27) |
| InChIKey | LNHMSLWBHJZZKC-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 82.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.51 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |