C17H20N4O3 — CID 53088770
6-(azepane-1-carbonyl)-4-methyl-2-phenyl-1,2,4-triazine-3,5-dione (PubChem CID 53088770) has the molecular formula C17H20N4O3 and a molecular weight of 328.37 g/mol. Its IUPAC name is 6-(azepane-1-carbonyl)-4-methyl-2-phenyl-1,2,4-triazine-3,5-dione.
| Compound Name | 6-(azepane-1-carbonyl)-4-methyl-2-phenyl-1,2,4-triazine-3,5-dione |
|---|---|
| PubChem CID | 53088770 |
| Molecular Formula | C17H20N4O3 |
| Molecular Weight | 328.37 g/mol |
| Exact Mass | 328.15 |
| IUPAC Name | 6-(azepane-1-carbonyl)-4-methyl-2-phenyl-1,2,4-triazine-3,5-dione |
| SMILES | Cn1c(=O)c(C(=O)N2CCCCCC2)nn(-c2ccccc2)c1=O |
| InChI | InChI=1S/C17H20N4O3/c1-19-15(22)14(16(23)20-11-7-2-3-8-12-20)18-21(17(19)24)13-9-5-4-6-10-13/h4-6,9-10H,2-3,7-8,11-12H2,1H3 |
| InChIKey | YCMMJMJQSTUWIK-UHFFFAOYSA-N |
| XLogP | 0.95 |
| TPSA | 77.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.37 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |