C24H29N3O — CID 171543540
ethane;(4-methyl-1,5-diphenylpyrazol-3-yl)-piperidin-1-ylmethanone (PubChem CID 171543540) has the molecular formula C24H29N3O and a molecular weight of 375.52 g/mol. Its IUPAC name is ethane;(4-methyl-1,5-diphenylpyrazol-3-yl)-piperidin-1-ylmethanone.
| Compound Name | ethane;(4-methyl-1,5-diphenylpyrazol-3-yl)-piperidin-1-ylmethanone |
|---|---|
| PubChem CID | 171543540 |
| Molecular Formula | C24H29N3O |
| Molecular Weight | 375.52 g/mol |
| Exact Mass | 375.23 |
| IUPAC Name | ethane;(4-methyl-1,5-diphenylpyrazol-3-yl)-piperidin-1-ylmethanone |
| SMILES | CC.Cc1c(C(=O)N2CCCCC2)nn(-c2ccccc2)c1-c1ccccc1 |
| InChI | InChI=1S/C22H23N3O.C2H6/c1-17-20(22(26)24-15-9-4-10-16-24)23-25(19-13-7-3-8-14-19)21(17)18-11-5-2-6-12-18;1-2/h2-3,5-8,11-14H,4,9-10,15-16H2,1H3;1-2H3 |
| InChIKey | XXKVYVIHRUNANH-UHFFFAOYSA-N |
| XLogP | 5.50 |
| TPSA | 38.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.52 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |