C24H22N2O2 — CID 53089405
N-(4-ethylphenyl)-2-(2-phenylethyl)-1,3-benzoxazole-6-carboxamide (PubChem CID 53089405) has the molecular formula C24H22N2O2 and a molecular weight of 370.45 g/mol. Its IUPAC name is N-(4-ethylphenyl)-2-(2-phenylethyl)-1,3-benzoxazole-6-carboxamide.
| Compound Name | N-(4-ethylphenyl)-2-(2-phenylethyl)-1,3-benzoxazole-6-carboxamide |
|---|---|
| PubChem CID | 53089405 |
| Molecular Formula | C24H22N2O2 |
| Molecular Weight | 370.45 g/mol |
| Exact Mass | 370.17 |
| IUPAC Name | N-(4-ethylphenyl)-2-(2-phenylethyl)-1,3-benzoxazole-6-carboxamide |
| SMILES | CCc1ccc(NC(=O)c2ccc3nc(CCc4ccccc4)oc3c2)cc1 |
| InChI | InChI=1S/C24H22N2O2/c1-2-17-8-12-20(13-9-17)25-24(27)19-11-14-21-22(16-19)28-23(26-21)15-10-18-6-4-3-5-7-18/h3-9,11-14,16H,2,10,15H2,1H3,(H,25,27) |
| InChIKey | VVANYNQUTNYGGW-UHFFFAOYSA-N |
| XLogP | 5.43 |
| TPSA | 55.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.45 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |