C14H20F2OSi — CID 530904
cyclohexyl-(3,5-difluorophenoxy)-dimethylsilane (PubChem CID 530904) has the molecular formula C14H20F2OSi and a molecular weight of 270.39 g/mol. Its IUPAC name is cyclohexyl-(3,5-difluorophenoxy)-dimethylsilane.
| Compound Name | cyclohexyl-(3,5-difluorophenoxy)-dimethylsilane |
|---|---|
| PubChem CID | 530904 |
| Molecular Formula | C14H20F2OSi |
| Molecular Weight | 270.39 g/mol |
| Exact Mass | 270.13 |
| IUPAC Name | cyclohexyl-(3,5-difluorophenoxy)-dimethylsilane |
| SMILES | C[Si](C)(Oc1cc(F)cc(F)c1)C1CCCCC1 |
| InChI | InChI=1S/C14H20F2OSi/c1-18(2,14-6-4-3-5-7-14)17-13-9-11(15)8-12(16)10-13/h8-10,14H,3-7H2,1-2H3 |
| InChIKey | ACUVKVFCQAMUKY-UHFFFAOYSA-N |
| XLogP | 4.88 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.39 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|