C23H21F2N3O5 — CID 5309043
ethyl 4-[5-[(2,4-difluorophenyl)carbamoyl]-1,3-dioxoisoindol-2-yl]piperidine-1-carboxylate (PubChem CID 5309043) has the molecular formula C23H21F2N3O5 and a molecular weight of 457.43 g/mol. Its IUPAC name is ethyl 4-[5-[(2,4-difluorophenyl)carbamoyl]-1,3-dioxoisoindol-2-yl]piperidine-1-carboxylate.
| Compound Name | ethyl 4-[5-[(2,4-difluorophenyl)carbamoyl]-1,3-dioxoisoindol-2-yl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 5309043 |
| Molecular Formula | C23H21F2N3O5 |
| Molecular Weight | 457.43 g/mol |
| Exact Mass | 457.14 |
| IUPAC Name | ethyl 4-[5-[(2,4-difluorophenyl)carbamoyl]-1,3-dioxoisoindol-2-yl]piperidine-1-carboxylate |
| SMILES | CCOC(=O)N1CCC(N2C(=O)c3ccc(C(=O)Nc4ccc(F)cc4F)cc3C2=O)CC1 |
| InChI | InChI=1S/C23H21F2N3O5/c1-2-33-23(32)27-9-7-15(8-10-27)28-21(30)16-5-3-13(11-17(16)22(28)31)20(29)26-19-6-4-14(24)12-18(19)25/h3-6,11-12,15H,2,7-10H2,1H3,(H,26,29) |
| InChIKey | ZEYQKGBGAMZYTB-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 96.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.43 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|