C16H16N2O3S — CID 5309069
3-(2-methoxyethyl)-1-prop-2-enyl-[1]benzothiolo[3,2-d]pyrimidine-2,4-dione (PubChem CID 5309069) has the molecular formula C16H16N2O3S and a molecular weight of 316.38 g/mol. Its IUPAC name is 3-(2-methoxyethyl)-1-prop-2-enyl-[1]benzothiolo[3,2-d]pyrimidine-2,4-dione.
| Compound Name | 3-(2-methoxyethyl)-1-prop-2-enyl-[1]benzothiolo[3,2-d]pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 5309069 |
| Molecular Formula | C16H16N2O3S |
| Molecular Weight | 316.38 g/mol |
| Exact Mass | 316.09 |
| IUPAC Name | 3-(2-methoxyethyl)-1-prop-2-enyl-[1]benzothiolo[3,2-d]pyrimidine-2,4-dione |
| SMILES | C=CCn1c(=O)n(CCOC)c(=O)c2sc3ccccc3c21 |
| InChI | InChI=1S/C16H16N2O3S/c1-3-8-17-13-11-6-4-5-7-12(11)22-14(13)15(19)18(16(17)20)9-10-21-2/h3-7H,1,8-10H2,2H3 |
| InChIKey | JBSKHSQORPHOAK-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 53.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.38 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|