C10H6N2O3S — CID 11528774
3-hydroxy-1H-[1]benzothiolo[3,2-d]pyrimidine-2,4-dione (PubChem CID 11528774) has the molecular formula C10H6N2O3S and a molecular weight of 234.24 g/mol. Its IUPAC name is 3-hydroxy-1H-[1]benzothiolo[3,2-d]pyrimidine-2,4-dione.
| Compound Name | 3-hydroxy-1H-[1]benzothiolo[3,2-d]pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 11528774 |
| Molecular Formula | C10H6N2O3S |
| Molecular Weight | 234.24 g/mol |
| Exact Mass | 234.01 |
| IUPAC Name | 3-hydroxy-1H-[1]benzothiolo[3,2-d]pyrimidine-2,4-dione |
| SMILES | O=c1[nH]c2c(sc3ccccc32)c(=O)n1O |
| InChI | InChI=1S/C10H6N2O3S/c13-9-8-7(11-10(14)12(9)15)5-3-1-2-4-6(5)16-8/h1-4,15H,(H,11,14) |
| InChIKey | ZRRRXSJGAQWFHX-UHFFFAOYSA-N |
| XLogP | 1.14 |
| TPSA | 75.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.24 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'N-hydroxyl_pyridine', 'substructure': 'N/A'} |
|---|