C24H26N6O2 — CID 53090783
N-[[4-(dimethylamino)phenyl]methyl]-2-(3,7-dimethyl-4-oxo-2-phenylpyrazolo[3,4-d]pyridazin-5-yl)acetamide (PubChem CID 53090783) has the molecular formula C24H26N6O2 and a molecular weight of 430.51 g/mol. Its IUPAC name is N-[[4-(dimethylamino)phenyl]methyl]-2-(3,7-dimethyl-4-oxo-2-phenylpyrazolo[3,4-d]pyridazin-5-yl)acetamide.
| Compound Name | N-[[4-(dimethylamino)phenyl]methyl]-2-(3,7-dimethyl-4-oxo-2-phenylpyrazolo[3,4-d]pyridazin-5-yl)acetamide |
|---|---|
| PubChem CID | 53090783 |
| Molecular Formula | C24H26N6O2 |
| Molecular Weight | 430.51 g/mol |
| Exact Mass | 430.21 |
| IUPAC Name | N-[[4-(dimethylamino)phenyl]methyl]-2-(3,7-dimethyl-4-oxo-2-phenylpyrazolo[3,4-d]pyridazin-5-yl)acetamide |
| SMILES | Cc1nn(CC(=O)NCc2ccc(N(C)C)cc2)c(=O)c2c(C)n(-c3ccccc3)nc12 |
| InChI | InChI=1S/C24H26N6O2/c1-16-23-22(17(2)30(27-23)20-8-6-5-7-9-20)24(32)29(26-16)15-21(31)25-14-18-10-12-19(13-11-18)28(3)4/h5-13H,14-15H2,1-4H3,(H,25,31) |
| InChIKey | DWRFEXKTGXJACM-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 85.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.51 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|